C21H25ClN4O3 — CID 139395997
3-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-1-N-(2-methoxyethyl)-2,6-naphthyridine-1,7-diamine (PubChem CID 139395997) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 3-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-1-N-(2-methoxyethyl)-2,6-naphthyridine-1,7-diamine.
| Compound Name | 3-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-1-N-(2-methoxyethyl)-2,6-naphthyridine-1,7-diamine |
|---|---|
| PubChem CID | 139395997 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-1-N-(2-methoxyethyl)-2,6-naphthyridine-1,7-diamine |
| SMILES | CCc1c(OC)cc(OC)c(Cl)c1-c1cc2cnc(N)cc2c(NCCOC)n1 |
| InChI | InChI=1S/C21H25ClN4O3/c1-5-13-16(28-3)10-17(29-4)20(22)19(13)15-8-12-11-25-18(23)9-14(12)21(26-15)24-6-7-27-2/h8-11H,5-7H2,1-4H3,(H2,23,25)(H,24,26) |
| InChIKey | KFBKMFSJBDCSBV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|