C19H19ClN2O2 — CID 142295606
6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline (PubChem CID 142295606) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline.
| Compound Name | 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline |
|---|---|
| PubChem CID | 142295606 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline |
| SMILES | CCc1c(OC)cc(OC)c(Cl)c1-c1ccc2nc(C)ncc2c1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-5-14-16(23-3)9-17(24-4)19(20)18(14)12-6-7-15-13(8-12)10-21-11(2)22-15/h6-10H,5H2,1-4H3 |
| InChIKey | ULGHCITXQXAIDS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |