About 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline
6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline (PubChem CID 142295606) has the molecular formula C19H19ClN2O2
and a molecular weight of 342.83 g/mol. Its IUPAC name is 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline.
Molecular Properties
| Compound Name | 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline |
| PubChem CID | 142295606 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline |
| SMILES | CCc1c(OC)cc(OC)c(Cl)c1-c1ccc2nc(C)ncc2c1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-5-14-16(23-3)9-17(24-4)19(20)18(14)12-6-7-15-13(8-12)10-21-11(2)22-15/h6-10H,5H2,1-4H3 |
| InChIKey | ULGHCITXQXAIDS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline?
The IUPAC name of 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline (CID 142295606) is 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline.
What is the SMILES notation for 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline?
The canonical SMILES for 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline is CCc1c(OC)cc(OC)c(Cl)c1-c1ccc2nc(C)ncc2c1.
What is the InChIKey of 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline?
The InChIKey is ULGHCITXQXAIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O2/c1-5-14-16(23-3)9-17(24-4)19(20)18(14)12-6-7-15-13(8-12)10-21-11(2)22-15/h6-10H,5H2,1-4H3.
What are the key properties of 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline?
6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline has a molecular weight of 342.83 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2-methylquinazoline is sourced from PubChem (CID 142295606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).