C24H28Cl2N4O3 — CID 144836225
cyclopentane;6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;prop-2-enamide (PubChem CID 144836225) has the molecular formula C24H28Cl2N4O3 and a molecular weight of 491.42 g/mol. Its IUPAC name is cyclopentane;6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;prop-2-enamide.
| Compound Name | cyclopentane;6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;prop-2-enamide |
|---|---|
| PubChem CID | 144836225 |
| Molecular Formula | C24H28Cl2N4O3 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | cyclopentane;6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;prop-2-enamide |
| SMILES | C1CCCC1.C=CC(N)=O.COc1cc(OC)c(Cl)c(-c2ccc3nc(N)ncc3c2)c1Cl |
| InChI | InChI=1S/C16H13Cl2N3O2.C5H10.C3H5NO/c1-22-11-6-12(23-2)15(18)13(14(11)17)8-3-4-10-9(5-8)7-20-16(19)21-10;1-2-4-5-3-1;1-2-3(4)5/h3-7H,1-2H3,(H2,19,20,21);1-5H2;2H,1H2,(H2,4,5) |
| InChIKey | JEWTYNXXUFMARX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|