C24H28Cl2N4O4 — CID 145111775
6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;oxane;prop-2-enamide (PubChem CID 145111775) has the molecular formula C24H28Cl2N4O4 and a molecular weight of 507.42 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;oxane;prop-2-enamide.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;oxane;prop-2-enamide |
|---|---|
| PubChem CID | 145111775 |
| Molecular Formula | C24H28Cl2N4O4 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-amine;oxane;prop-2-enamide |
| SMILES | C1CCOCC1.C=CC(N)=O.COc1cc(OC)c(Cl)c(-c2ccc3nc(N)ncc3c2)c1Cl |
| InChI | InChI=1S/C16H13Cl2N3O2.C5H10O.C3H5NO/c1-22-11-6-12(23-2)15(18)13(14(11)17)8-3-4-10-9(5-8)7-20-16(19)21-10;1-2-4-6-5-3-1;1-2-3(4)5/h3-7H,1-2H3,(H2,19,20,21);1-5H2;2H,1H2,(H2,4,5) |
| InChIKey | RGDBLBJFADKKKW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|