C25H24Cl2N4O2 — CID 163805352
N-[(2R)-2-[[6-(2,6-dichloro-3-methoxy-5-methylphenyl)quinazolin-2-yl]amino]cyclohexylidene]prop-2-enamide (PubChem CID 163805352) has the molecular formula C25H24Cl2N4O2 and a molecular weight of 483.40 g/mol. Its IUPAC name is N-[(2R)-2-[[6-(2,6-dichloro-3-methoxy-5-methylphenyl)quinazolin-2-yl]amino]cyclohexylidene]prop-2-enamide.
| Compound Name | N-[(2R)-2-[[6-(2,6-dichloro-3-methoxy-5-methylphenyl)quinazolin-2-yl]amino]cyclohexylidene]prop-2-enamide |
|---|---|
| PubChem CID | 163805352 |
| Molecular Formula | C25H24Cl2N4O2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[(2R)-2-[[6-(2,6-dichloro-3-methoxy-5-methylphenyl)quinazolin-2-yl]amino]cyclohexylidene]prop-2-enamide |
| SMILES | C=CC(=O)/N=C1\CCCC[C@H]1Nc1ncc2cc(-c3c(Cl)c(C)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C25H24Cl2N4O2/c1-4-21(32)29-18-7-5-6-8-19(18)31-25-28-13-16-12-15(9-10-17(16)30-25)22-23(26)14(2)11-20(33-3)24(22)27/h4,9-13,19H,1,5-8H2,2-3H3,(H,28,30,31)/b29-18+/t19-/m1/s1 |
| InChIKey | NIOFNEBCHPZNHU-YPKLGXIKSA-N |
| XLogP | 6.43 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|