C28H26FN3O4 — CID 118232093
N-[3-[3-(3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide (PubChem CID 118232093) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is N-[3-[3-(3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide.
| Compound Name | N-[3-[3-(3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118232093 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-[3-[3-(3,5-dimethoxyphenyl)-2-oxo-1-propan-2-yl-1,6-naphthyridin-7-yl]-4-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(-c2cc3c(cn2)cc(-c2cc(OC)cc(OC)c2)c(=O)n3C(C)C)c1 |
| InChI | InChI=1S/C28H26FN3O4/c1-6-27(33)31-19-7-8-24(29)23(12-19)25-14-26-18(15-30-25)11-22(28(34)32(26)16(2)3)17-9-20(35-4)13-21(10-17)36-5/h6-16H,1H2,2-5H3,(H,31,33) |
| InChIKey | CVDUKEWPLFFDGS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|