C24H25NO4 — CID 134596988
3-(2-oxo-3-phenyl-1-propan-2-ylquinolin-7-yl)oxypropyl prop-2-enoate (PubChem CID 134596988) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(2-oxo-3-phenyl-1-propan-2-ylquinolin-7-yl)oxypropyl prop-2-enoate.
| Compound Name | 3-(2-oxo-3-phenyl-1-propan-2-ylquinolin-7-yl)oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 134596988 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-(2-oxo-3-phenyl-1-propan-2-ylquinolin-7-yl)oxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc2cc(-c3ccccc3)c(=O)n(C(C)C)c2c1 |
| InChI | InChI=1S/C24H25NO4/c1-4-23(26)29-14-8-13-28-20-12-11-19-15-21(18-9-6-5-7-10-18)24(27)25(17(2)3)22(19)16-20/h4-7,9-12,15-17H,1,8,13-14H2,2-3H3 |
| InChIKey | DWUOUQCTENHVDC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|