C44H39NO6 — CID 135254020
3-[4-(4-phenanthren-9-yl-N-[4-(3-prop-2-enoyloxypropoxy)phenyl]anilino)phenoxy]propyl prop-2-enoate (PubChem CID 135254020) has the molecular formula C44H39NO6 and a molecular weight of 677.80 g/mol. Its IUPAC name is 3-[4-(4-phenanthren-9-yl-N-[4-(3-prop-2-enoyloxypropoxy)phenyl]anilino)phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-(4-phenanthren-9-yl-N-[4-(3-prop-2-enoyloxypropoxy)phenyl]anilino)phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 135254020 |
| Molecular Formula | C44H39NO6 |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 3-[4-(4-phenanthren-9-yl-N-[4-(3-prop-2-enoyloxypropoxy)phenyl]anilino)phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(N(c2ccc(OCCCOC(=O)C=C)cc2)c2ccc(-c3cc4ccccc4c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C44H39NO6/c1-3-43(46)50-29-9-27-48-37-23-19-35(20-24-37)45(36-21-25-38(26-22-36)49-28-10-30-51-44(47)4-2)34-17-15-32(16-18-34)42-31-33-11-5-6-12-39(33)40-13-7-8-14-41(40)42/h3-8,11-26,31H,1-2,9-10,27-30H2 |
| InChIKey | PLKBXPPBTSFUBQ-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|