C49H45NO6 — CID 135253996
3-[4-[N-[4-methyl-3-[4-(4-phenylphenyl)phenyl]phenyl]-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate (PubChem CID 135253996) has the molecular formula C49H45NO6 and a molecular weight of 743.90 g/mol. Its IUPAC name is 3-[4-[N-[4-methyl-3-[4-(4-phenylphenyl)phenyl]phenyl]-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[N-[4-methyl-3-[4-(4-phenylphenyl)phenyl]phenyl]-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 135253996 |
| Molecular Formula | C49H45NO6 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | 3-[4-[N-[4-methyl-3-[4-(4-phenylphenyl)phenyl]phenyl]-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(N(c2ccc(OCCCOC(=O)C=C)cc2)c2ccc(C)c(-c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C49H45NO6/c1-4-48(51)55-33-9-31-53-45-27-23-42(24-28-45)50(43-25-29-46(30-26-43)54-32-10-34-56-49(52)5-2)44-22-13-36(3)47(35-44)41-20-18-40(19-21-41)39-16-14-38(15-17-39)37-11-7-6-8-12-37/h4-8,11-30,35H,1-2,9-10,31-34H2,3H3 |
| InChIKey | UZQPJNMHISCFNH-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|