C45H41NO6 — CID 135253989
3-[4-[N-(4-methyl-3-phenanthren-9-ylphenyl)-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate (PubChem CID 135253989) has the molecular formula C45H41NO6 and a molecular weight of 691.82 g/mol. Its IUPAC name is 3-[4-[N-(4-methyl-3-phenanthren-9-ylphenyl)-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[N-(4-methyl-3-phenanthren-9-ylphenyl)-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 135253989 |
| Molecular Formula | C45H41NO6 |
| Molecular Weight | 691.82 g/mol |
| Exact Mass | 691.29 |
| IUPAC Name | 3-[4-[N-(4-methyl-3-phenanthren-9-ylphenyl)-4-(3-prop-2-enoyloxypropoxy)anilino]phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(N(c2ccc(OCCCOC(=O)C=C)cc2)c2ccc(C)c(-c3cc4ccccc4c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C45H41NO6/c1-4-44(47)51-28-10-26-49-37-22-18-34(19-23-37)46(35-20-24-38(25-21-35)50-27-11-29-52-45(48)5-2)36-17-16-32(3)42(31-36)43-30-33-12-6-7-13-39(33)40-14-8-9-15-41(40)43/h4-9,12-25,30-31H,1-2,10-11,26-29H2,3H3 |
| InChIKey | LPGZGQXJRRXLRY-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.82 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|