C58H64N2O6 — CID 58937618
[4-[N-(3,4-dimethylphenyl)-4-[10-[4-[N-(3,4-dimethylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenoxy]decoxy]anilino]phenyl]methyl prop-2-enoate (PubChem CID 58937618) has the molecular formula C58H64N2O6 and a molecular weight of 885.16 g/mol. Its IUPAC name is [4-[N-(3,4-dimethylphenyl)-4-[10-[4-[N-(3,4-dimethylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenoxy]decoxy]anilino]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[N-(3,4-dimethylphenyl)-4-[10-[4-[N-(3,4-dimethylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenoxy]decoxy]anilino]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 58937618 |
| Molecular Formula | C58H64N2O6 |
| Molecular Weight | 885.16 g/mol |
| Exact Mass | 884.48 |
| IUPAC Name | [4-[N-(3,4-dimethylphenyl)-4-[10-[4-[N-(3,4-dimethylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenoxy]decoxy]anilino]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(N(c2ccc(OCCCCCCCCCCOc3ccc(N(c4ccc(COC(=O)C=C)cc4)c4ccc(C)c(C)c4)cc3)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C58H64N2O6/c1-7-57(61)65-41-47-19-25-49(26-20-47)59(53-23-17-43(3)45(5)39-53)51-29-33-55(34-30-51)63-37-15-13-11-9-10-12-14-16-38-64-56-35-31-52(32-36-56)60(54-24-18-44(4)46(6)40-54)50-27-21-48(22-28-50)42-66-58(62)8-2/h7-8,17-36,39-40H,1-2,9-16,37-38,41-42H2,3-6H3 |
| InChIKey | MOLQJCIPUNGNDD-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.16 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|