C47H40N4O10 — CID 22089911
[4-(4-nitro-N-[4-[4-[4-(4-nitro-N-(4-prop-2-enoyloxyphenyl)anilino)phenoxy]butoxy]phenyl]anilino)phenyl]methyl prop-2-enoate (PubChem CID 22089911) has the molecular formula C47H40N4O10 and a molecular weight of 820.86 g/mol. Its IUPAC name is [4-(4-nitro-N-[4-[4-[4-(4-nitro-N-(4-prop-2-enoyloxyphenyl)anilino)phenoxy]butoxy]phenyl]anilino)phenyl]methyl prop-2-enoate.
| Compound Name | [4-(4-nitro-N-[4-[4-[4-(4-nitro-N-(4-prop-2-enoyloxyphenyl)anilino)phenoxy]butoxy]phenyl]anilino)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 22089911 |
| Molecular Formula | C47H40N4O10 |
| Molecular Weight | 820.86 g/mol |
| Exact Mass | 820.27 |
| IUPAC Name | [4-(4-nitro-N-[4-[4-[4-(4-nitro-N-(4-prop-2-enoyloxyphenyl)anilino)phenoxy]butoxy]phenyl]anilino)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(N(c2ccc(OCCCCOc3ccc(N(c4ccc(OC(=O)C=C)cc4)c4ccc([N+](=O)[O-])cc4)cc3)cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C47H40N4O10/c1-3-46(52)60-33-34-7-9-35(10-8-34)48(36-11-15-41(16-12-36)50(54)55)38-19-25-43(26-20-38)58-31-5-6-32-59-44-27-21-39(22-28-44)49(37-13-17-42(18-14-37)51(56)57)40-23-29-45(30-24-40)61-47(53)4-2/h3-4,7-30H,1-2,5-6,31-33H2 |
| InChIKey | LCOSKGFLUMHMKU-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 163.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.86 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|