C22H21NO7 — CID 101254258
6-O-[(4-ethoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2E,4E)-hexa-2,4-dienedioate (PubChem CID 101254258) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 6-O-[(4-ethoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2E,4E)-hexa-2,4-dienedioate.
| Compound Name | 6-O-[(4-ethoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2E,4E)-hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 101254258 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 6-O-[(4-ethoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2E,4E)-hexa-2,4-dienedioate |
| SMILES | CCOc1ccc(COC(=O)/C=C/C=C/C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H21NO7/c1-2-28-20-13-9-18(10-14-20)16-30-22(25)6-4-3-5-21(24)29-15-17-7-11-19(12-8-17)23(26)27/h3-14H,2,15-16H2,1H3/b5-3+,6-4+ |
| InChIKey | HEECRJTYWKQJRK-GGWOSOGESA-N |
| XLogP | 3.89 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|