C15H24N2O6 — CID 88663538
N,N-diethylethanamine;(4-nitrophenyl)methyl 2-oxoacetate;hydrate (PubChem CID 88663538) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is N,N-diethylethanamine;(4-nitrophenyl)methyl 2-oxoacetate;hydrate.
| Compound Name | N,N-diethylethanamine;(4-nitrophenyl)methyl 2-oxoacetate;hydrate |
|---|---|
| PubChem CID | 88663538 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N,N-diethylethanamine;(4-nitrophenyl)methyl 2-oxoacetate;hydrate |
| SMILES | CCN(CC)CC.O.O=CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7NO5.C6H15N.H2O/c11-5-9(12)15-6-7-1-3-8(4-2-7)10(13)14;1-4-7(5-2)6-3;/h1-5H,6H2;4-6H2,1-3H3;1H2 |
| InChIKey | LWYLFVBEOULTNW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 121.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|