C32H35NO4 — CID 89328506
[4-[N-(3-butyl-4-methylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 89328506) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is [4-[N-(3-butyl-4-methylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[N-(3-butyl-4-methylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89328506 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | [4-[N-(3-butyl-4-methylphenyl)-4-(prop-2-enoyloxymethyl)anilino]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(N(c2ccc(COC(=O)C(=C)C)cc2)c2ccc(C)c(CCCC)c2)cc1 |
| InChI | InChI=1S/C32H35NO4/c1-6-8-9-27-20-30(15-10-24(27)5)33(28-16-11-25(12-17-28)21-36-31(34)7-2)29-18-13-26(14-19-29)22-37-32(35)23(3)4/h7,10-20H,2-3,6,8-9,21-22H2,1,4-5H3 |
| InChIKey | HTHXNQSCBXCKCZ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|