C42H39NO4 — CID 58961751
[4-(4-methyl-N-[4-[[4-[2-[4-(2-oxobut-3-enoxy)phenyl]ethyl]phenyl]methyl]phenyl]anilino)phenyl]methyl prop-2-enoate (PubChem CID 58961751) has the molecular formula C42H39NO4 and a molecular weight of 621.78 g/mol. Its IUPAC name is [4-(4-methyl-N-[4-[[4-[2-[4-(2-oxobut-3-enoxy)phenyl]ethyl]phenyl]methyl]phenyl]anilino)phenyl]methyl prop-2-enoate.
| Compound Name | [4-(4-methyl-N-[4-[[4-[2-[4-(2-oxobut-3-enoxy)phenyl]ethyl]phenyl]methyl]phenyl]anilino)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 58961751 |
| Molecular Formula | C42H39NO4 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | [4-(4-methyl-N-[4-[[4-[2-[4-(2-oxobut-3-enoxy)phenyl]ethyl]phenyl]methyl]phenyl]anilino)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)COc1ccc(CCc2ccc(Cc3ccc(N(c4ccc(C)cc4)c4ccc(COC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H39NO4/c1-4-40(44)30-46-41-26-18-33(19-27-41)9-8-32-10-12-34(13-11-32)28-35-14-22-38(23-15-35)43(37-20-6-31(3)7-21-37)39-24-16-36(17-25-39)29-47-42(45)5-2/h4-7,10-27H,1-2,8-9,28-30H2,3H3 |
| InChIKey | ULHDKILWDIQRRC-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|