C48H47NO6 — CID 135254008
3-[4-[4-(3-prop-2-enoyloxypropoxy)-N-(6,6,12,12-tetramethylindeno[2,1-h]fluoren-1-yl)anilino]phenoxy]propyl prop-2-enoate (PubChem CID 135254008) has the molecular formula C48H47NO6 and a molecular weight of 733.90 g/mol. Its IUPAC name is 3-[4-[4-(3-prop-2-enoyloxypropoxy)-N-(6,6,12,12-tetramethylindeno[2,1-h]fluoren-1-yl)anilino]phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[4-(3-prop-2-enoyloxypropoxy)-N-(6,6,12,12-tetramethylindeno[2,1-h]fluoren-1-yl)anilino]phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 135254008 |
| Molecular Formula | C48H47NO6 |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.34 |
| IUPAC Name | 3-[4-[4-(3-prop-2-enoyloxypropoxy)-N-(6,6,12,12-tetramethylindeno[2,1-h]fluoren-1-yl)anilino]phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(N(c2ccc(OCCCOC(=O)C=C)cc2)c2cccc3c2C(C)(C)c2cc4c(cc2-3)C(C)(C)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C48H47NO6/c1-7-44(50)54-28-12-26-52-34-22-18-32(19-23-34)49(33-20-24-35(25-21-33)53-27-13-29-55-45(51)8-2)43-17-11-15-37-39-31-41-38(30-42(39)48(5,6)46(37)43)36-14-9-10-16-40(36)47(41,3)4/h7-11,14-25,30-31H,1-2,12-13,26-29H2,3-6H3 |
| InChIKey | FSPFLOSIZDMIAD-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|