C33H35NO3 — CID 146342157
3-[(8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)oxy]propyl prop-2-enoate (PubChem CID 146342157) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is 3-[(8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)oxy]propyl prop-2-enoate.
| Compound Name | 3-[(8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)oxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 146342157 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 3-[(8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)oxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1cc2c3c(c1)C(C)(C)c1cccc4c1N3c1c(cccc1C2(C)C)C4(C)C |
| InChI | InChI=1S/C33H35NO3/c1-8-27(35)37-17-11-16-36-20-18-25-30-26(19-20)33(6,7)24-15-10-13-22-29(24)34(30)28-21(31(22,2)3)12-9-14-23(28)32(25,4)5/h8-10,12-15,18-19H,1,11,16-17H2,2-7H3 |
| InChIKey | AMXQGLIQTYRQBQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|