C46H57NO4 — CID 146342296
6-[5,11,14,14,17,22,22-heptamethyl-8-(6-prop-2-enoyloxyhexyl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-8-yl]hexyl prop-2-enoate (PubChem CID 146342296) has the molecular formula C46H57NO4 and a molecular weight of 687.96 g/mol. Its IUPAC name is 6-[5,11,14,14,17,22,22-heptamethyl-8-(6-prop-2-enoyloxyhexyl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-8-yl]hexyl prop-2-enoate.
| Compound Name | 6-[5,11,14,14,17,22,22-heptamethyl-8-(6-prop-2-enoyloxyhexyl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-8-yl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 146342296 |
| Molecular Formula | C46H57NO4 |
| Molecular Weight | 687.96 g/mol |
| Exact Mass | 687.43 |
| IUPAC Name | 6-[5,11,14,14,17,22,22-heptamethyl-8-(6-prop-2-enoyloxyhexyl)-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-8-yl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCC1(CCCCCCOC(=O)C=C)c2cc(C)cc3c2N2c4c(cc(C)cc4C(C)(C)c4cc(C)cc1c42)C3(C)C |
| InChI | InChI=1S/C46H57NO4/c1-10-39(48)50-22-18-14-12-16-20-46(21-17-13-15-19-23-51-40(49)11-2)37-28-31(4)26-35-42(37)47-41-33(44(35,6)7)24-30(3)25-34(41)45(8,9)36-27-32(5)29-38(46)43(36)47/h10-11,24-29H,1-2,12-23H2,3-9H3 |
| InChIKey | NUVKPZBDLMJNOB-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.96 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|