C50H48O4 — CID 134419462
5-[2-[10-(4-methylphenyl)anthracen-9-yl]-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate (PubChem CID 134419462) has the molecular formula C50H48O4 and a molecular weight of 712.93 g/mol. Its IUPAC name is 5-[2-[10-(4-methylphenyl)anthracen-9-yl]-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate.
| Compound Name | 5-[2-[10-(4-methylphenyl)anthracen-9-yl]-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 134419462 |
| Molecular Formula | C50H48O4 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.36 |
| IUPAC Name | 5-[2-[10-(4-methylphenyl)anthracen-9-yl]-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1(CCCCCOC(=O)C=C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4ccc(C)cc4)c4ccccc34)cc21 |
| InChI | InChI=1S/C50H48O4/c1-4-46(51)53-32-16-6-14-30-50(31-15-7-17-33-54-47(52)5-2)44-23-13-12-18-38(44)39-29-28-37(34-45(39)50)49-42-21-10-8-19-40(42)48(36-26-24-35(3)25-27-36)41-20-9-11-22-43(41)49/h4-5,8-13,18-29,34H,1-2,6-7,14-17,30-33H2,3H3 |
| InChIKey | HXPGIJLHZFLQII-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|