C60H54O8 — CID 118652615
[2-[10-[9-(propanoyloxymethyl)-9-(3-prop-2-enoyloxypropyl)fluoren-2-yl]anthracen-9-yl]-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]methyl propanoate (PubChem CID 118652615) has the molecular formula C60H54O8 and a molecular weight of 903.08 g/mol. Its IUPAC name is [2-[10-[9-(propanoyloxymethyl)-9-(3-prop-2-enoyloxypropyl)fluoren-2-yl]anthracen-9-yl]-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]methyl propanoate.
| Compound Name | [2-[10-[9-(propanoyloxymethyl)-9-(3-prop-2-enoyloxypropyl)fluoren-2-yl]anthracen-9-yl]-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]methyl propanoate |
|---|---|
| PubChem CID | 118652615 |
| Molecular Formula | C60H54O8 |
| Molecular Weight | 903.08 g/mol |
| Exact Mass | 902.38 |
| IUPAC Name | [2-[10-[9-(propanoyloxymethyl)-9-(3-prop-2-enoyloxypropyl)fluoren-2-yl]anthracen-9-yl]-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]methyl propanoate |
| SMILES | C=CC(=O)OCCCC1(COC(=O)CC)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4ccc5c(c4)C(CCCOC(=O)C=C)(COC(=O)CC)c4ccccc4-5)c4ccccc34)cc21 |
| InChI | InChI=1S/C60H54O8/c1-5-53(61)65-33-17-31-59(37-67-55(63)7-3)49-25-15-13-19-41(49)43-29-27-39(35-51(43)59)57-45-21-9-11-23-47(45)58(48-24-12-10-22-46(48)57)40-28-30-44-42-20-14-16-26-50(42)60(52(44)36-40,38-68-56(64)8-4)32-18-34-66-54(62)6-2/h5-6,9-16,19-30,35-36H,1-2,7-8,17-18,31-34,37-38H2,3-4H3 |
| InChIKey | DCRNUFDKRGZWBJ-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.08 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|