C41H34O2 — CID 118652517
3-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]propyl prop-2-enoate (PubChem CID 118652517) has the molecular formula C41H34O2 and a molecular weight of 558.72 g/mol. Its IUPAC name is 3-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]propyl prop-2-enoate.
| Compound Name | 3-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 118652517 |
| Molecular Formula | C41H34O2 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 3-[4-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(-c2c3ccccc3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccccc23)cc1 |
| InChI | InChI=1S/C41H34O2/c1-4-38(42)43-25-11-12-27-19-21-28(22-20-27)39-32-14-5-7-16-34(32)40(35-17-8-6-15-33(35)39)29-23-24-31-30-13-9-10-18-36(30)41(2,3)37(31)26-29/h4-10,13-24,26H,1,11-12,25H2,2-3H3 |
| InChIKey | MGNVAPKUGGWGMH-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|