C37H33F3O2 — CID 129041346
4-[9,9-dimethyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]butyl prop-2-enoate (PubChem CID 129041346) has the molecular formula C37H33F3O2 and a molecular weight of 566.66 g/mol. Its IUPAC name is 4-[9,9-dimethyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]butyl prop-2-enoate.
| Compound Name | 4-[9,9-dimethyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 129041346 |
| Molecular Formula | C37H33F3O2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 4-[9,9-dimethyl-7-[9-methyl-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1ccc2c(c1)C(C)(C)c1cc(-c3ccc4c(c3)C(C)(C(F)(F)F)c3ccccc3-4)ccc1-2 |
| InChI | InChI=1S/C37H33F3O2/c1-5-34(41)42-19-9-8-10-23-13-16-27-28-17-14-24(21-32(28)35(2,3)31(27)20-23)25-15-18-29-26-11-6-7-12-30(26)36(4,33(29)22-25)37(38,39)40/h5-7,11-18,20-22H,1,8-10,19H2,2-4H3 |
| InChIKey | DTSDBPMNOZIQHE-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|