C56H45F3O6 — CID 129041394
[9,9-dimethyl-7-[9-methyl-7-[7-methyl-9,9-bis(prop-2-enoyloxymethyl)fluoren-2-yl]-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]methyl prop-2-enoate (PubChem CID 129041394) has the molecular formula C56H45F3O6 and a molecular weight of 870.96 g/mol. Its IUPAC name is [9,9-dimethyl-7-[9-methyl-7-[7-methyl-9,9-bis(prop-2-enoyloxymethyl)fluoren-2-yl]-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]methyl prop-2-enoate.
| Compound Name | [9,9-dimethyl-7-[9-methyl-7-[7-methyl-9,9-bis(prop-2-enoyloxymethyl)fluoren-2-yl]-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 129041394 |
| Molecular Formula | C56H45F3O6 |
| Molecular Weight | 870.96 g/mol |
| Exact Mass | 870.32 |
| IUPAC Name | [9,9-dimethyl-7-[9-methyl-7-[7-methyl-9,9-bis(prop-2-enoyloxymethyl)fluoren-2-yl]-9-(trifluoromethyl)fluoren-2-yl]fluoren-2-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc2c(c1)C(C)(C)c1cc(-c3ccc4c(c3)C(C)(C(F)(F)F)c3cc(-c5ccc6c(c5)C(COC(=O)C=C)(COC(=O)C=C)c5cc(C)ccc5-6)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C56H45F3O6/c1-8-50(60)63-29-33-12-18-38-39-19-13-34(25-45(39)53(5,6)44(38)24-33)35-14-20-40-41-21-15-36(27-47(41)54(7,46(40)26-35)56(57,58)59)37-16-22-43-42-17-11-32(4)23-48(42)55(49(43)28-37,30-64-51(61)9-2)31-65-52(62)10-3/h8-28H,1-3,29-31H2,4-7H3 |
| InChIKey | XIVXXJYHBAGGNV-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.96 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|