C46H33F3O4 — CID 129041335
[2-fluoranthen-3-yl-9-(prop-2-enoyloxymethyl)-7-[3-(3,3,3-trifluoropropyl)phenyl]fluoren-9-yl]methyl prop-2-enoate (PubChem CID 129041335) has the molecular formula C46H33F3O4 and a molecular weight of 706.76 g/mol. Its IUPAC name is [2-fluoranthen-3-yl-9-(prop-2-enoyloxymethyl)-7-[3-(3,3,3-trifluoropropyl)phenyl]fluoren-9-yl]methyl prop-2-enoate.
| Compound Name | [2-fluoranthen-3-yl-9-(prop-2-enoyloxymethyl)-7-[3-(3,3,3-trifluoropropyl)phenyl]fluoren-9-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 129041335 |
| Molecular Formula | C46H33F3O4 |
| Molecular Weight | 706.76 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | [2-fluoranthen-3-yl-9-(prop-2-enoyloxymethyl)-7-[3-(3,3,3-trifluoropropyl)phenyl]fluoren-9-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(COC(=O)C=C)c2cc(-c3cccc(CCC(F)(F)F)c3)ccc2-c2ccc(-c3ccc4c5c(cccc35)-c3ccccc3-4)cc21 |
| InChI | InChI=1S/C46H33F3O4/c1-3-42(50)52-26-45(27-53-43(51)4-2)40-24-30(29-10-7-9-28(23-29)21-22-46(47,48)49)15-17-35(40)36-18-16-31(25-41(36)45)32-19-20-39-34-12-6-5-11-33(34)38-14-8-13-37(32)44(38)39/h3-20,23-25H,1-2,21-22,26-27H2 |
| InChIKey | YUHXMSADHITWDX-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.76 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|