C41H34O4 — CID 118933483
4-[3-[12-[3-(prop-2-enoyloxymethyl)phenyl]chrysen-6-yl]phenyl]butyl prop-2-enoate (PubChem CID 118933483) has the molecular formula C41H34O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-[3-[12-[3-(prop-2-enoyloxymethyl)phenyl]chrysen-6-yl]phenyl]butyl prop-2-enoate.
| Compound Name | 4-[3-[12-[3-(prop-2-enoyloxymethyl)phenyl]chrysen-6-yl]phenyl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 118933483 |
| Molecular Formula | C41H34O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 4-[3-[12-[3-(prop-2-enoyloxymethyl)phenyl]chrysen-6-yl]phenyl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1cccc(-c2cc3c4ccccc4c(-c4cccc(COC(=O)C=C)c4)cc3c3ccccc23)c1 |
| InChI | InChI=1S/C41H34O4/c1-3-40(42)44-22-10-9-13-28-14-11-16-30(23-28)36-25-38-35-21-8-6-19-33(35)37(26-39(38)34-20-7-5-18-32(34)36)31-17-12-15-29(24-31)27-45-41(43)4-2/h3-8,11-12,14-21,23-26H,1-2,9-10,13,22,27H2 |
| InChIKey | RMTXDEVMANTCRZ-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|