C38H40O6 — CID 166678332
[(E)-6-[3-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]hex-5-enyl] (E)-3-[3-(4-prop-2-enoyloxybutyl)phenyl]prop-2-enoate (PubChem CID 166678332) has the molecular formula C38H40O6 and a molecular weight of 592.73 g/mol. Its IUPAC name is [(E)-6-[3-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]hex-5-enyl] (E)-3-[3-(4-prop-2-enoyloxybutyl)phenyl]prop-2-enoate.
| Compound Name | [(E)-6-[3-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]hex-5-enyl] (E)-3-[3-(4-prop-2-enoyloxybutyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 166678332 |
| Molecular Formula | C38H40O6 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | [(E)-6-[3-[(E)-3-oxo-3-phenylmethoxyprop-1-enyl]phenyl]hex-5-enyl] (E)-3-[3-(4-prop-2-enoyloxybutyl)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1cccc(/C=C/C(=O)OCCCC/C=C/c2cccc(/C=C/C(=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C38H40O6/c1-2-36(39)42-27-11-9-15-32-19-13-20-33(29-32)22-24-37(40)43-26-10-4-3-6-14-31-18-12-21-34(28-31)23-25-38(41)44-30-35-16-7-5-8-17-35/h2,5-8,12-14,16-25,28-29H,1,3-4,9-11,15,26-27,30H2/b14-6+,24-22+,25-23+ |
| InChIKey | WJPMQJNKMQBPSU-OPUVAPLFSA-N |
| XLogP | 7.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|