C29H34O4 — CID 138663179
[(E)-6-[3-[4-[4-(prop-2-enoyloxymethyl)phenyl]butyl]phenyl]hex-5-enyl] prop-2-enoate (PubChem CID 138663179) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is [(E)-6-[3-[4-[4-(prop-2-enoyloxymethyl)phenyl]butyl]phenyl]hex-5-enyl] prop-2-enoate.
| Compound Name | [(E)-6-[3-[4-[4-(prop-2-enoyloxymethyl)phenyl]butyl]phenyl]hex-5-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 138663179 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [(E)-6-[3-[4-[4-(prop-2-enoyloxymethyl)phenyl]butyl]phenyl]hex-5-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC/C=C/c1cccc(CCCCc2ccc(COC(=O)C=C)cc2)c1 |
| InChI | InChI=1S/C29H34O4/c1-3-28(30)32-21-10-6-5-7-13-25-15-11-16-26(22-25)14-9-8-12-24-17-19-27(20-18-24)23-33-29(31)4-2/h3-4,7,11,13,15-20,22H,1-2,5-6,8-10,12,14,21,23H2/b13-7+ |
| InChIKey | MOXBAOXBQWXWFQ-NTUHNPAUSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|