C38H50N4O6 — CID 158591215
6-[4-[diamino-[3-[diamino-[4-(6-prop-2-enoyloxyhexyl)phenyl]methoxy]phenoxy]methyl]phenyl]hexyl prop-2-enoate (PubChem CID 158591215) has the molecular formula C38H50N4O6 and a molecular weight of 658.84 g/mol. Its IUPAC name is 6-[4-[diamino-[3-[diamino-[4-(6-prop-2-enoyloxyhexyl)phenyl]methoxy]phenoxy]methyl]phenyl]hexyl prop-2-enoate.
| Compound Name | 6-[4-[diamino-[3-[diamino-[4-(6-prop-2-enoyloxyhexyl)phenyl]methoxy]phenoxy]methyl]phenyl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 158591215 |
| Molecular Formula | C38H50N4O6 |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.37 |
| IUPAC Name | 6-[4-[diamino-[3-[diamino-[4-(6-prop-2-enoyloxyhexyl)phenyl]methoxy]phenoxy]methyl]phenyl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCc1ccc(C(N)(N)Oc2cccc(OC(N)(N)c3ccc(CCCCCCOC(=O)C=C)cc3)c2)cc1 |
| InChI | InChI=1S/C38H50N4O6/c1-3-35(43)45-26-11-7-5-9-14-29-18-22-31(23-19-29)37(39,40)47-33-16-13-17-34(28-33)48-38(41,42)32-24-20-30(21-25-32)15-10-6-8-12-27-46-36(44)4-2/h3-4,13,16-25,28H,1-2,5-12,14-15,26-27,39-42H2 |
| InChIKey | HULSMXDRTCLCGM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|