C29H32F4O5 — CID 89283497
5-[4-[[2,6-difluoro-4-(5-prop-2-enoyloxypentyl)phenyl]-difluoromethoxy]phenyl]pentyl prop-2-enoate (PubChem CID 89283497) has the molecular formula C29H32F4O5 and a molecular weight of 536.56 g/mol. Its IUPAC name is 5-[4-[[2,6-difluoro-4-(5-prop-2-enoyloxypentyl)phenyl]-difluoromethoxy]phenyl]pentyl prop-2-enoate.
| Compound Name | 5-[4-[[2,6-difluoro-4-(5-prop-2-enoyloxypentyl)phenyl]-difluoromethoxy]phenyl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 89283497 |
| Molecular Formula | C29H32F4O5 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 5-[4-[[2,6-difluoro-4-(5-prop-2-enoyloxypentyl)phenyl]-difluoromethoxy]phenyl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCc1ccc(OC(F)(F)c2c(F)cc(CCCCCOC(=O)C=C)cc2F)cc1 |
| InChI | InChI=1S/C29H32F4O5/c1-3-26(34)36-17-9-5-7-11-21-13-15-23(16-14-21)38-29(32,33)28-24(30)19-22(20-25(28)31)12-8-6-10-18-37-27(35)4-2/h3-4,13-16,19-20H,1-2,5-12,17-18H2 |
| InChIKey | KTADLDSRVYDSKG-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|