C34H44F4O5 — CID 126755948
6-[4-[difluoro-[4-[6-(2-methylprop-2-enoyloxy)hexyl]phenoxy]methyl]-3,5-difluorophenyl]hexyl 2,2-dimethylpropanoate (PubChem CID 126755948) has the molecular formula C34H44F4O5 and a molecular weight of 608.71 g/mol. Its IUPAC name is 6-[4-[difluoro-[4-[6-(2-methylprop-2-enoyloxy)hexyl]phenoxy]methyl]-3,5-difluorophenyl]hexyl 2,2-dimethylpropanoate.
| Compound Name | 6-[4-[difluoro-[4-[6-(2-methylprop-2-enoyloxy)hexyl]phenoxy]methyl]-3,5-difluorophenyl]hexyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126755948 |
| Molecular Formula | C34H44F4O5 |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | 6-[4-[difluoro-[4-[6-(2-methylprop-2-enoyloxy)hexyl]phenoxy]methyl]-3,5-difluorophenyl]hexyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCCCCCc1ccc(OC(F)(F)c2c(F)cc(CCCCCCOC(=O)C(C)(C)C)cc2F)cc1 |
| InChI | InChI=1S/C34H44F4O5/c1-24(2)31(39)41-20-12-8-6-10-14-25-16-18-27(19-17-25)43-34(37,38)30-28(35)22-26(23-29(30)36)15-11-7-9-13-21-42-32(40)33(3,4)5/h16-19,22-23H,1,6-15,20-21H2,2-5H3 |
| InChIKey | UKMQLPWDRDFLHQ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|