C31H34F6O5 — CID 89253371
6-[4-[[3,5-difluoro-4-(6-prop-2-enoyloxyhexyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]hexyl prop-2-enoate (PubChem CID 89253371) has the molecular formula C31H34F6O5 and a molecular weight of 600.60 g/mol. Its IUPAC name is 6-[4-[[3,5-difluoro-4-(6-prop-2-enoyloxyhexyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]hexyl prop-2-enoate.
| Compound Name | 6-[4-[[3,5-difluoro-4-(6-prop-2-enoyloxyhexyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 89253371 |
| Molecular Formula | C31H34F6O5 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 6-[4-[[3,5-difluoro-4-(6-prop-2-enoyloxyhexyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCc1cc(F)c(C(F)(F)Oc2cc(F)c(CCCCCCOC(=O)C=C)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H34F6O5/c1-3-28(38)40-15-11-7-5-9-13-21-17-26(34)30(27(35)18-21)31(36,37)42-22-19-24(32)23(25(33)20-22)14-10-6-8-12-16-41-29(39)4-2/h3-4,17-20H,1-2,5-16H2 |
| InChIKey | FYDFCEUJMUYVJV-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|