C44H50F8O8 — CID 58776316
6-[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]hexyl prop-2-enoate (PubChem CID 58776316) has the molecular formula C44H50F8O8 and a molecular weight of 858.86 g/mol. Its IUPAC name is 6-[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 58776316 |
| Molecular Formula | C44H50F8O8 |
| Molecular Weight | 858.86 g/mol |
| Exact Mass | 858.34 |
| IUPAC Name | 6-[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCCOc2ccc(OCCCc3ccc(OCCCCCCOC(=O)C=C)cc3F)c(C(F)(F)F)c2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C44H50F8O8/c1-3-39(53)59-25-11-7-5-9-23-55-33-19-17-31(35(45)29-33)15-13-27-57-37-21-22-38(42(44(50,51)52)41(37)43(47,48)49)58-28-14-16-32-18-20-34(30-36(32)46)56-24-10-6-8-12-26-60-40(54)4-2/h3-4,17-22,29-30H,1-2,5-16,23-28H2 |
| InChIKey | YYHWQOOVQCRBIP-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.86 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|