C37H30F12O8 — CID 89249967
[4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 89249967) has the molecular formula C37H30F12O8 and a molecular weight of 830.61 g/mol. Its IUPAC name is [4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 89249967 |
| Molecular Formula | C37H30F12O8 |
| Molecular Weight | 830.61 g/mol |
| Exact Mass | 830.17 |
| IUPAC Name | [4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCOC(=O)C=C)c(C(F)(F)F)c3C(F)(F)F)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C37H30F12O8/c1-3-27(50)55-19-7-5-17-53-22-11-9-21(10-12-22)33(52)57-26-16-14-24(30(35(41,42)43)32(26)37(47,48)49)23-13-15-25(54-18-6-8-20-56-28(51)4-2)31(36(44,45)46)29(23)34(38,39)40/h3-4,9-16H,1-2,5-8,17-20H2 |
| InChIKey | OHBMERDYPTVCFK-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.61 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|