C28H20BF9O6 — CID 162582027
3-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3,2-dioxaborinan-5-yl]-3,5-difluorophenoxy]propyl prop-2-enoate (PubChem CID 162582027) has the molecular formula C28H20BF9O6 and a molecular weight of 634.26 g/mol. Its IUPAC name is 3-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3,2-dioxaborinan-5-yl]-3,5-difluorophenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3,2-dioxaborinan-5-yl]-3,5-difluorophenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 162582027 |
| Molecular Formula | C28H20BF9O6 |
| Molecular Weight | 634.26 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | 3-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3,2-dioxaborinan-5-yl]-3,5-difluorophenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1cc(F)c(C2COB(c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)OC2)c(F)c1 |
| InChI | InChI=1S/C28H20BF9O6/c1-2-24(39)41-5-3-4-40-16-8-18(30)25(19(31)9-16)14-12-42-29(43-13-14)15-6-20(32)26(21(33)7-15)28(37,38)44-17-10-22(34)27(36)23(35)11-17/h2,6-11,14H,1,3-5,12-13H2 |
| InChIKey | ATVUGUOCLFPIOW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.26 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|