C21H20BF7O — CID 59330230
1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3,3,4,4-tetramethylborolane (PubChem CID 59330230) has the molecular formula C21H20BF7O and a molecular weight of 432.19 g/mol. Its IUPAC name is 1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3,3,4,4-tetramethylborolane.
| Compound Name | 1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3,3,4,4-tetramethylborolane |
|---|---|
| PubChem CID | 59330230 |
| Molecular Formula | C21H20BF7O |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3,3,4,4-tetramethylborolane |
| SMILES | CC1(C)CB(c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)CC1(C)C |
| InChI | InChI=1S/C21H20BF7O/c1-19(2)9-22(10-20(19,3)4)11-5-13(23)17(14(24)6-11)21(28,29)30-12-7-15(25)18(27)16(26)8-12/h5-8H,9-10H2,1-4H3 |
| InChIKey | AJZCXGRHTPRBHG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|