C13H6BF7O3 — CID 172764620
[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]boronic acid (PubChem CID 172764620) has the molecular formula C13H6BF7O3 and a molecular weight of 353.99 g/mol. Its IUPAC name is [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]boronic acid.
| Compound Name | [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]boronic acid |
|---|---|
| PubChem CID | 172764620 |
| Molecular Formula | C13H6BF7O3 |
| Molecular Weight | 353.99 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(F)cc(F)c1C(F)(F)Oc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H6BF7O3/c15-5-1-7(14(22)23)11(8(16)2-5)13(20,21)24-6-3-9(17)12(19)10(18)4-6/h1-4,22-23H |
| InChIKey | MDKQHNMUVVULTD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.99 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|