C14H7F7O — CID 118604500
1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluoro-4-methylbenzene (PubChem CID 118604500) has the molecular formula C14H7F7O and a molecular weight of 324.20 g/mol. Its IUPAC name is 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 118604500 |
| Molecular Formula | C14H7F7O |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(C(F)(F)Oc2cc(F)c(F)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C14H7F7O/c1-6-2-3-8(12(18)11(6)17)14(20,21)22-7-4-9(15)13(19)10(16)5-7/h2-5H,1H3 |
| InChIKey | CQRWMRXTMFZFTO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|