C34H24F14O4 — CID 122542614
1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[7-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenoxy]-4-methylheptoxy]-2,3-difluorobenzene (PubChem CID 122542614) has the molecular formula C34H24F14O4 and a molecular weight of 762.53 g/mol. Its IUPAC name is 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[7-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenoxy]-4-methylheptoxy]-2,3-difluorobenzene.
| Compound Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[7-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenoxy]-4-methylheptoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 122542614 |
| Molecular Formula | C34H24F14O4 |
| Molecular Weight | 762.53 g/mol |
| Exact Mass | 762.15 |
| IUPAC Name | 1-[difluoro-(3,4,5-trifluorophenoxy)methyl]-4-[7-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenoxy]-4-methylheptoxy]-2,3-difluorobenzene |
| SMILES | CC(CCCOc1ccc(C(F)(F)Oc2cc(F)c(F)c(F)c2)c(F)c1F)CCCOc1ccc(C(F)(F)Oc2cc(F)c(F)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C34H24F14O4/c1-16(4-2-10-49-25-8-6-19(27(39)31(25)43)33(45,46)51-17-12-21(35)29(41)22(36)13-17)5-3-11-50-26-9-7-20(28(40)32(26)44)34(47,48)52-18-14-23(37)30(42)24(38)15-18/h6-9,12-16H,2-5,10-11H2,1H3 |
| InChIKey | XBQLJKHCYSQPRX-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.53 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|