C15H12F4O3 — CID 145151828
4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]phenol (PubChem CID 145151828) has the molecular formula C15H12F4O3 and a molecular weight of 316.25 g/mol. Its IUPAC name is 4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]phenol.
| Compound Name | 4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]phenol |
|---|---|
| PubChem CID | 145151828 |
| Molecular Formula | C15H12F4O3 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-[(4-ethoxy-2,3-difluorophenyl)-difluoromethoxy]phenol |
| SMILES | CCOc1ccc(C(F)(F)Oc2ccc(O)cc2)c(F)c1F |
| InChI | InChI=1S/C15H12F4O3/c1-2-21-12-8-7-11(13(16)14(12)17)15(18,19)22-10-5-3-9(20)4-6-10/h3-8,20H,2H2,1H3 |
| InChIKey | SVCSCGCNNCZYKV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |