C21H23F5O2 — CID 58953415
2-(difluoromethyl)-1-[difluoro-(4-pentylphenoxy)methyl]-4-ethoxy-3-fluorobenzene (PubChem CID 58953415) has the molecular formula C21H23F5O2 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-[difluoro-(4-pentylphenoxy)methyl]-4-ethoxy-3-fluorobenzene.
| Compound Name | 2-(difluoromethyl)-1-[difluoro-(4-pentylphenoxy)methyl]-4-ethoxy-3-fluorobenzene |
|---|---|
| PubChem CID | 58953415 |
| Molecular Formula | C21H23F5O2 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-(difluoromethyl)-1-[difluoro-(4-pentylphenoxy)methyl]-4-ethoxy-3-fluorobenzene |
| SMILES | CCCCCc1ccc(OC(F)(F)c2ccc(OCC)c(F)c2C(F)F)cc1 |
| InChI | InChI=1S/C21H23F5O2/c1-3-5-6-7-14-8-10-15(11-9-14)28-21(25,26)16-12-13-17(27-4-2)19(22)18(16)20(23)24/h8-13,20H,3-7H2,1-2H3 |
| InChIKey | JNZIQYVKBDCNLR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|