C29H28F6O — CID 88552614
2-[difluoro-(4-pentylphenoxy)methyl]-1,8,9,10-tetrafluoro-7-propyl-9,10-dihydrophenanthrene (PubChem CID 88552614) has the molecular formula C29H28F6O and a molecular weight of 506.53 g/mol. Its IUPAC name is 2-[difluoro-(4-pentylphenoxy)methyl]-1,8,9,10-tetrafluoro-7-propyl-9,10-dihydrophenanthrene.
| Compound Name | 2-[difluoro-(4-pentylphenoxy)methyl]-1,8,9,10-tetrafluoro-7-propyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 88552614 |
| Molecular Formula | C29H28F6O |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[difluoro-(4-pentylphenoxy)methyl]-1,8,9,10-tetrafluoro-7-propyl-9,10-dihydrophenanthrene |
| SMILES | CCCCCc1ccc(OC(F)(F)c2ccc3c(c2F)C(F)C(F)c2c-3ccc(CCC)c2F)cc1 |
| InChI | InChI=1S/C29H28F6O/c1-3-5-6-8-17-9-12-19(13-10-17)36-29(34,35)22-16-15-21-20-14-11-18(7-4-2)25(30)23(20)27(32)28(33)24(21)26(22)31/h9-16,27-28H,3-8H2,1-2H3 |
| InChIKey | OOBPRRSCIYOTNP-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|