C29H28F8O2 — CID 59592305
4-[difluoro-[4-(4-pentylphenyl)phenoxy]methyl]-1-ethoxy-5-methyl-2,3-bis(trifluoromethyl)benzene (PubChem CID 59592305) has the molecular formula C29H28F8O2 and a molecular weight of 560.53 g/mol. Its IUPAC name is 4-[difluoro-[4-(4-pentylphenyl)phenoxy]methyl]-1-ethoxy-5-methyl-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 4-[difluoro-[4-(4-pentylphenyl)phenoxy]methyl]-1-ethoxy-5-methyl-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 59592305 |
| Molecular Formula | C29H28F8O2 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 4-[difluoro-[4-(4-pentylphenyl)phenoxy]methyl]-1-ethoxy-5-methyl-2,3-bis(trifluoromethyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(OC(F)(F)c3c(C)cc(OCC)c(C(F)(F)F)c3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H28F8O2/c1-4-6-7-8-19-9-11-20(12-10-19)21-13-15-22(16-14-21)39-29(36,37)24-18(3)17-23(38-5-2)25(27(30,31)32)26(24)28(33,34)35/h9-17H,4-8H2,1-3H3 |
| InChIKey | OZEZXUWNEZVMQT-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|