C27H20F4O5 — CID 122593536
[4-[4-[[2,3-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-difluoromethoxy]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 122593536) has the molecular formula C27H20F4O5 and a molecular weight of 500.44 g/mol. Its IUPAC name is [4-[4-[[2,3-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-difluoromethoxy]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[[2,3-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-difluoromethoxy]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122593536 |
| Molecular Formula | C27H20F4O5 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | [4-[4-[[2,3-difluoro-4-(2-methylprop-2-enoyloxy)phenyl]-difluoromethoxy]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OC(F)(F)c3ccc(OC(=O)C(=C)C)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C27H20F4O5/c1-15(2)25(32)34-19-9-5-17(6-10-19)18-7-11-20(12-8-18)36-27(30,31)21-13-14-22(24(29)23(21)28)35-26(33)16(3)4/h5-14H,1,3H2,2,4H3 |
| InChIKey | VGHGVXOFEVZSHE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|