C20H10ClF7O — CID 129159287
2-chloro-1-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-fluoro-4-methylbenzene (PubChem CID 129159287) has the molecular formula C20H10ClF7O and a molecular weight of 434.74 g/mol. Its IUPAC name is 2-chloro-1-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-fluoro-4-methylbenzene.
| Compound Name | 2-chloro-1-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 129159287 |
| Molecular Formula | C20H10ClF7O |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-chloro-1-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(C(F)(F)Oc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)c(Cl)c1F |
| InChI | InChI=1S/C20H10ClF7O/c1-9-2-5-13(17(21)18(9)25)20(27,28)29-11-3-4-12(14(22)8-11)10-6-15(23)19(26)16(24)7-10/h2-8H,1H3 |
| InChIKey | WRPHOYOQHKAYMA-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|