C26H14F8O — CID 118603334
1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-2,3-difluoro-4-(4-methylphenyl)benzene (PubChem CID 118603334) has the molecular formula C26H14F8O and a molecular weight of 494.38 g/mol. Its IUPAC name is 1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-2,3-difluoro-4-(4-methylphenyl)benzene.
| Compound Name | 1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 118603334 |
| Molecular Formula | C26H14F8O |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 1-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-2,3-difluoro-4-(4-methylphenyl)benzene |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H14F8O/c1-13-2-4-14(5-3-13)17-7-8-18(24(31)23(17)30)15-6-9-19(20(27)10-15)26(33,34)35-16-11-21(28)25(32)22(29)12-16/h2-12H,1H3 |
| InChIKey | NYELKZQDVYQAEC-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|