C30H17F7O — CID 118900750
6-[[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]-difluoromethoxy]-1,2,3-trifluoronaphthalene (PubChem CID 118900750) has the molecular formula C30H17F7O and a molecular weight of 526.45 g/mol. Its IUPAC name is 6-[[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]-difluoromethoxy]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]-difluoromethoxy]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 118900750 |
| Molecular Formula | C30H17F7O |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 6-[[2,3-difluoro-4-[4-(4-methylphenyl)phenyl]phenyl]-difluoromethoxy]-1,2,3-trifluoronaphthalene |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C(F)(F)Oc4ccc5c(F)c(F)c(F)cc5c4)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C30H17F7O/c1-16-2-4-17(5-3-16)18-6-8-19(9-7-18)22-12-13-24(28(34)26(22)32)30(36,37)38-21-10-11-23-20(14-21)15-25(31)29(35)27(23)33/h2-15H,1H3 |
| InChIKey | NXEULFZJJOWRAC-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|