C27H19F7O2 — CID 118858748
6-[2-[4-(2,3-difluoro-4-propylphenyl)phenoxy]-1,1-difluoroethoxy]-1,2,3-trifluoronaphthalene (PubChem CID 118858748) has the molecular formula C27H19F7O2 and a molecular weight of 508.43 g/mol. Its IUPAC name is 6-[2-[4-(2,3-difluoro-4-propylphenyl)phenoxy]-1,1-difluoroethoxy]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-(2,3-difluoro-4-propylphenyl)phenoxy]-1,1-difluoroethoxy]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 118858748 |
| Molecular Formula | C27H19F7O2 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 6-[2-[4-(2,3-difluoro-4-propylphenyl)phenoxy]-1,1-difluoroethoxy]-1,2,3-trifluoronaphthalene |
| SMILES | CCCc1ccc(-c2ccc(OCC(F)(F)Oc3ccc4c(F)c(F)c(F)cc4c3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H19F7O2/c1-2-3-16-6-10-20(24(30)23(16)29)15-4-7-18(8-5-15)35-14-27(33,34)36-19-9-11-21-17(12-19)13-22(28)26(32)25(21)31/h4-13H,2-3,14H2,1H3 |
| InChIKey | UGNMFYQRYRHFRR-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|