C27H29F3O — CID 58141396
2,3-difluoro-1-[4-[(3-fluoro-4-propylphenoxy)methyl]phenyl]-4-pentylbenzene (PubChem CID 58141396) has the molecular formula C27H29F3O and a molecular weight of 426.52 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[(3-fluoro-4-propylphenoxy)methyl]phenyl]-4-pentylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[(3-fluoro-4-propylphenoxy)methyl]phenyl]-4-pentylbenzene |
|---|---|
| PubChem CID | 58141396 |
| Molecular Formula | C27H29F3O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2,3-difluoro-1-[4-[(3-fluoro-4-propylphenoxy)methyl]phenyl]-4-pentylbenzene |
| SMILES | CCCCCc1ccc(-c2ccc(COc3ccc(CCC)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H29F3O/c1-3-5-6-8-22-14-16-24(27(30)26(22)29)20-11-9-19(10-12-20)18-31-23-15-13-21(7-4-2)25(28)17-23/h9-17H,3-8,18H2,1-2H3 |
| InChIKey | MBYROVNEQFSATR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|