C14H6BF9O3 — CID 58444589
[4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]boronic acid (PubChem CID 58444589) has the molecular formula C14H6BF9O3 and a molecular weight of 403.99 g/mol. Its IUPAC name is [4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]boronic acid.
| Compound Name | [4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]boronic acid |
|---|---|
| PubChem CID | 58444589 |
| Molecular Formula | C14H6BF9O3 |
| Molecular Weight | 403.99 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | [4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(F)c(C(F)(F)Oc2cc(F)c(C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H6BF9O3/c16-7-1-5(15(25)26)2-8(17)12(7)14(23,24)27-6-3-9(18)11(10(19)4-6)13(20,21)22/h1-4,25-26H |
| InChIKey | YEELAXBNMXRWNS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.99 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|